C48H31NO — CID 170676821
2,3,4,5,6,7,8-heptadeuterio-N-(4-dibenzofuran-4-ylphenyl)-N-(4-phenanthren-2-ylphenyl)naphthalen-1-amine (PubChem CID 170676821) has the molecular formula C48H31NO and a molecular weight of 644.82 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-(4-dibenzofuran-4-ylphenyl)-N-(4-phenanthren-2-ylphenyl)naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-dibenzofuran-4-ylphenyl)-N-(4-phenanthren-2-ylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 170676821 |
| Molecular Formula | C48H31NO |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-dibenzofuran-4-ylphenyl)-N-(4-phenanthren-2-ylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N(c3ccc(-c4ccc5c(ccc6ccccc65)c4)cc3)c3ccc(-c4cccc5c4oc4ccccc45)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C48H31NO/c1-3-12-40-34(10-1)19-20-37-31-36(25-30-41(37)40)32-21-26-38(27-22-32)49(46-17-7-11-33-9-2-4-13-42(33)46)39-28-23-35(24-29-39)43-15-8-16-45-44-14-5-6-18-47(44)50-48(43)45/h1-31H/i2D,4D,7D,9D,11D,13D,17D |
| InChIKey | AOXODUYEZVKCCR-OKDUOYAGSA-N |
| XLogP | 13.85 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|