C44H27NO2 — CID 171738205
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738205) has the molecular formula C44H27NO2 and a molecular weight of 612.77 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738205 |
| Molecular Formula | C44H27NO2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3c2oc2ccccc23)c([2H])c(N(c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c2cccc3oc4c5ccccc5ccc4c23)c1[2H] |
| InChI | InChI=1S/C44H27NO2/c1-3-16-32-28(11-1)13-8-21-38(32)45(39-22-10-24-41-42(39)37-26-25-29-12-2-4-17-33(29)44(37)47-41)31-15-7-14-30(27-31)34-19-9-20-36-35-18-5-6-23-40(35)46-43(34)36/h1-27H/i1D,3D,7D,8D,11D,13D,14D,15D,16D,21D,27D |
| InChIKey | QDUNCJLJQAGDRI-NSCQUNJISA-N |
| XLogP | 12.93 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |