C46H29NOS — CID 171739233
N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,4,5-tetradeuterio-6-phenylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171739233) has the molecular formula C46H29NOS and a molecular weight of 651.86 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,4,5-tetradeuterio-6-phenylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,4,5-tetradeuterio-6-phenylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171739233 |
| Molecular Formula | C46H29NOS |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,4,5-tetradeuterio-6-phenylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2c([2H])c([2H])c([2H])c(-c3cccc4c3sc3ccccc34)c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c(-c2ccccc2)c1[2H] |
| InChI | InChI=1S/C46H29NOS/c1-2-13-30(14-3-1)34-18-6-8-23-40(34)47(41-24-12-25-42-44(41)39-28-27-31-15-4-5-19-35(31)45(39)48-42)33-17-10-16-32(29-33)36-21-11-22-38-37-20-7-9-26-43(37)49-46(36)38/h1-29H/i6D,8D,10D,16D,17D,18D,23D,29D |
| InChIKey | VXULFBMCPPMGSV-LSTSSFHPSA-N |
| XLogP | 13.91 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |