C40H25NO2 — CID 171738760
N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738760) has the molecular formula C40H25NO2 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738760 |
| Molecular Formula | C40H25NO2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2c([2H])c([2H])c([2H])c(-c3cccc4c3oc3ccccc34)c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C40H25NO2/c1-2-13-28(14-3-1)41(35-20-10-22-37-38(35)34-24-23-26-11-4-5-16-30(26)40(34)43-37)29-15-8-12-27(25-29)31-18-9-19-33-32-17-6-7-21-36(32)42-39(31)33/h1-25H/i1D,2D,3D,8D,12D,13D,14D,15D,25D |
| InChIKey | TWAKCHUTWIUTAO-LDTLNFPISA-N |
| XLogP | 11.78 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |