C56H35NO2 — CID 171739600
N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171739600) has the molecular formula C56H35NO2 and a molecular weight of 761.95 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171739600 |
| Molecular Formula | C56H35NO2 |
| Molecular Weight | 761.95 g/mol |
| Exact Mass | 761.32 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3c2oc2ccccc23)c([2H])c(N(c2c([2H])c([2H])c(-c3cccc(-c4cccc5ccccc45)c3)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c1[2H] |
| InChI | InChI=1S/C56H35NO2/c1-3-19-44-37(12-1)14-9-22-45(44)40-16-7-15-39(34-40)36-28-31-42(32-29-36)57(51-25-11-27-53-54(51)50-33-30-38-13-2-4-20-46(38)56(50)59-53)43-18-8-17-41(35-43)47-23-10-24-49-48-21-5-6-26-52(48)58-55(47)49/h1-35H/i8D,17D,18D,28D,29D,31D,32D,35D |
| InChIKey | IOPDNPSCLZWFKV-DPAUGPMHSA-N |
| XLogP | 16.26 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.95 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |