C54H35NO — CID 171737962
N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171737962) has the molecular formula C54H35NO and a molecular weight of 721.93 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171737962 |
| Molecular Formula | C54H35NO |
| Molecular Weight | 721.93 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2c([2H])c([2H])c(-c3cccc(-c4cccc5ccccc45)c3)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c1[2H] |
| InChI | InChI=1S/C54H35NO/c1-4-21-45-37(12-1)15-9-24-47(45)41-18-7-17-40(34-41)36-28-31-43(32-29-36)55(44-20-8-19-42(35-44)48-25-10-16-38-13-2-5-22-46(38)48)51-26-11-27-52-53(51)50-33-30-39-14-3-6-23-49(39)54(50)56-52/h1-35H/i8D,19D,20D,28D,29D,31D,32D,35D |
| InChIKey | VBDDFLSGFCZMEL-LHLVNTDSSA-N |
| XLogP | 15.52 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.93 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |