C48H31NO — CID 171737917
N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171737917) has the molecular formula C48H31NO and a molecular weight of 645.83 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171737917 |
| Molecular Formula | C48H31NO |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2c([2H])c([2H])c(-c3ccc4ccccc4c3)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c1[2H] |
| InChI | InChI=1S/C48H31NO/c1-2-13-36-30-37(23-22-32(36)10-1)33-24-27-39(28-25-33)49(40-16-7-15-38(31-40)42-19-8-14-34-11-3-5-17-41(34)42)45-20-9-21-46-47(45)44-29-26-35-12-4-6-18-43(35)48(44)50-46/h1-31H/i7D,15D,16D,24D,25D,27D,28D,31D |
| InChIKey | YSMRHCUUZVTLEM-NXDRRJGKSA-N |
| XLogP | 13.85 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |