C58H37NO — CID 171738789
N-[4-(4-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738789) has the molecular formula C58H37NO and a molecular weight of 767.96 g/mol. Its IUPAC name is N-[4-(4-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-[4-(4-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738789 |
| Molecular Formula | C58H37NO |
| Molecular Weight | 767.96 g/mol |
| Exact Mass | 767.31 |
| IUPAC Name | N-[4-(4-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc(-c4ccc5ccccc5c4)cc3)cc2)c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C58H37NO/c1-2-11-45-36-46(22-20-38(45)8-1)41-18-16-39(17-19-41)40-24-30-49(31-25-40)59(55-14-7-15-56-57(55)54-35-28-44-10-4-6-13-53(44)58(54)60-56)50-32-26-42(27-33-50)47-29-34-52-48(37-47)23-21-43-9-3-5-12-51(43)52/h1-37H/i26D,27D,32D,33D |
| InChIKey | CSQUVRWXGITLAW-SQQCOLCUSA-N |
| XLogP | 16.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.96 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|