C56H37NO — CID 171737811
N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171737811) has the molecular formula C56H37NO and a molecular weight of 747.97 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171737811 |
| Molecular Formula | C56H37NO |
| Molecular Weight | 747.97 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3cccc(-c4ccc5ccccc5c4)c3)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C56H37NO/c1-2-10-38(11-3-1)40-20-22-41(23-21-40)42-26-31-49(32-27-42)57(53-18-9-19-54-55(53)52-35-30-44-13-6-7-17-51(44)56(52)58-54)50-33-28-43(29-34-50)46-15-8-16-47(36-46)48-25-24-39-12-4-5-14-45(39)37-48/h1-37H/i26D,27D,28D,29D,31D,32D,33D,34D |
| InChIKey | JIXSOCLZGVGWGT-NWUVHXDMSA-N |
| XLogP | 16.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.97 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |