C58H37NO — CID 171739661
N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171739661) has the molecular formula C58H37NO and a molecular weight of 771.99 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171739661 |
| Molecular Formula | C58H37NO |
| Molecular Weight | 771.99 g/mol |
| Exact Mass | 771.34 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3cc4ccccc4c4ccccc34)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1cccc(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C58H37NO/c1-2-13-42-36-45(24-23-38(42)11-1)44-16-9-15-43(35-44)39-25-30-47(31-26-39)59(55-21-10-22-56-57(55)53-34-29-40-12-3-6-18-50(40)58(53)60-56)48-32-27-41(28-33-48)54-37-46-14-4-5-17-49(46)51-19-7-8-20-52(51)54/h1-37H/i25D,26D,27D,28D,30D,31D,32D,33D |
| InChIKey | DIMWCSMWCVGMFZ-ZTZIYFLJSA-N |
| XLogP | 16.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.99 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|