C46H29NO — CID 171739429
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171739429) has the molecular formula C46H29NO and a molecular weight of 622.81 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171739429 |
| Molecular Formula | C46H29NO |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C46H29NO/c1-5-16-36-30(11-1)14-9-20-42(36)47(43-21-10-22-44-45(43)40-28-25-31-12-2-6-17-37(31)46(40)48-44)34-26-23-32(24-27-34)41-29-33-13-3-4-15-35(33)38-18-7-8-19-39(38)41/h1-29H/i1D,5D,9D,11D,14D,16D,20D,23D,24D,26D,27D |
| InChIKey | HVQHBYLUWQZBMQ-BDCITGGMSA-N |
| XLogP | 13.34 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|