C42H27NO — CID 171738571
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738571) has the molecular formula C42H27NO and a molecular weight of 572.75 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738571 |
| Molecular Formula | C42H27NO |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C42H27NO/c1-4-15-33-28(10-1)13-7-18-34(33)31-22-25-32(26-23-31)43(38-19-8-14-29-11-2-5-16-35(29)38)39-20-9-21-40-41(39)37-27-24-30-12-3-6-17-36(30)42(37)44-40/h1-27H/i2D,5D,8D,11D,14D,16D,19D,22D,23D,25D,26D |
| InChIKey | HNBDPOFFDBGELC-HFTVGJJZSA-N |
| XLogP | 12.18 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |