C52H33NO — CID 167331237
2,3,4,5,6,7,8-heptadeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphthalen-1-amine (PubChem CID 167331237) has the molecular formula C52H33NO and a molecular weight of 698.91 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 167331237 |
| Molecular Formula | C52H33NO |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.33 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccccc2-c2cccc3oc4c5ccccc5ccc4c23)c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c([2H])c1-c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C52H33NO/c1-4-15-41-36(12-1)23-24-39-33-38(28-31-42(39)41)34-25-29-40(30-26-34)53(48-21-9-14-35-11-2-5-16-43(35)48)49-20-8-7-18-45(49)46-19-10-22-50-51(46)47-32-27-37-13-3-6-17-44(37)52(47)54-50/h1-33H/i2D,5D,9D,11D,14D,16D,21D,25D,26D,29D,30D |
| InChIKey | RYVRNYXEJBDXMS-GMQZRLDPSA-N |
| XLogP | 15.00 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|