C60H39NO — CID 167330307
2,3,5,6-tetradeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-4-phenanthren-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline (PubChem CID 167330307) has the molecular formula C60H39NO and a molecular weight of 798.03 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-4-phenanthren-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-4-phenanthren-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 167330307 |
| Molecular Formula | C60H39NO |
| Molecular Weight | 798.03 g/mol |
| Exact Mass | 797.35 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(2-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-4-phenanthren-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccccc2-c2cccc3oc4c5ccccc5ccc4c23)c2c([2H])c([2H])c(-c3ccc4c(ccc5ccccc54)c3)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C60H39NO/c1-2-12-40(13-3-1)45-16-10-17-46(38-45)41-26-32-49(33-27-41)61(50-34-28-42(29-35-50)47-31-36-52-48(39-47)25-24-43-14-4-6-18-51(43)52)57-22-9-8-20-54(57)55-21-11-23-58-59(55)56-37-30-44-15-5-7-19-53(44)60(56)62-58/h1-39H/i26D,27D,28D,29D,32D,33D,34D,35D |
| InChIKey | JPNVCDVIOYKSQD-FAEFDFKZSA-N |
| XLogP | 17.18 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.03 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|