C52H33NO2 — CID 171737306
N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171737306) has the molecular formula C52H33NO2 and a molecular weight of 711.89 g/mol. Its IUPAC name is N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171737306 |
| Molecular Formula | C52H33NO2 |
| Molecular Weight | 711.89 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3cccc4oc5ccccc5c34)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H33NO2/c1-2-10-34(11-3-1)35-20-22-36(23-21-35)37-24-29-40(30-25-37)53(46-16-9-19-49-51(46)45-33-28-38-12-4-5-13-43(38)52(45)55-49)41-31-26-39(27-32-41)42-15-8-18-48-50(42)44-14-6-7-17-47(44)54-48/h1-33H/i24D,25D,26D,27D,29D,30D,31D,32D |
| InChIKey | KTDYSVXDNYQAJL-TVWALIPGSA-N |
| XLogP | 15.11 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.89 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |