C50H31NO2 — CID 171738531
N-(4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738531) has the molecular formula C50H31NO2 and a molecular weight of 688.87 g/mol. Its IUPAC name is N-(4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738531 |
| Molecular Formula | C50H31NO2 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | N-(4-dibenzofuran-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4oc5ccccc5c34)cc2)c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C50H31NO2/c1-2-11-36-31-37(20-19-32(36)9-1)33-21-26-38(27-22-33)51(44-15-8-18-47-49(44)43-30-25-34-10-3-4-12-41(34)50(43)53-47)39-28-23-35(24-29-39)40-14-7-17-46-48(40)42-13-5-6-16-45(42)52-46/h1-31H/i1D,2D,9D,11D,19D,20D,21D,22D,26D,27D,31D |
| InChIKey | LTZUKYZAAWCITH-HMKHYNFUSA-N |
| XLogP | 14.60 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |