C54H35NO — CID 171738658
N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171738658) has the molecular formula C54H35NO and a molecular weight of 724.95 g/mol. Its IUPAC name is N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171738658 |
| Molecular Formula | C54H35NO |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.34 |
| IUPAC Name | N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc(-c4cccc5ccccc45)c3)cc2)c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C54H35NO/c1-2-13-41-34-43(23-22-36(41)10-1)38-26-31-46(32-27-38)55(51-20-9-21-52-53(51)50-33-28-40-12-4-6-18-49(40)54(50)56-52)45-29-24-37(25-30-45)42-15-7-16-44(35-42)48-19-8-14-39-11-3-5-17-47(39)48/h1-35H/i1D,2D,10D,13D,22D,23D,26D,27D,31D,32D,34D |
| InChIKey | BANWZCMOQHCFGA-ISTHZOHUSA-N |
| XLogP | 15.52 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |