C50H32N2O — CID 171739595
N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine (PubChem CID 171739595) has the molecular formula C50H32N2O and a molecular weight of 684.87 g/mol. Its IUPAC name is N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine.
| Compound Name | N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
|---|---|
| PubChem CID | 171739595 |
| Molecular Formula | C50H32N2O |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)naphtho[1,2-b][1]benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-n3c4ccccc4c4ccccc43)c([2H])c2[2H])c2cccc3oc4c5ccccc5ccc4c23)c([2H])c([2H])c1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H32N2O/c1-2-12-36-32-37(21-20-33(36)10-1)34-22-25-38(26-23-34)51(47-18-9-19-48-49(47)44-31-24-35-11-3-4-13-41(35)50(44)53-48)39-27-29-40(30-28-39)52-45-16-7-5-14-42(45)43-15-6-8-17-46(43)52/h1-32H/i22D,23D,25D,26D,27D,28D,29D,30D |
| InChIKey | FAIPYEZAJMXJGQ-SBAOSSSQSA-N |
| XLogP | 14.13 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |