C44H29NO — CID 170676838
N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]naphthalen-1-amine (PubChem CID 170676838) has the molecular formula C44H29NO and a molecular weight of 598.79 g/mol. Its IUPAC name is N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]naphthalen-1-amine.
| Compound Name | N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 170676838 |
| Molecular Formula | C44H29NO |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)c2cccc3ccccc23)c([2H])c([2H])c1-c1c([2H])c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c12 |
| InChI | InChI=1S/C44H29NO/c1-3-14-36-30(10-1)12-7-17-37(36)32-22-26-34(27-23-32)45(42-20-8-13-31-11-2-4-15-38(31)42)35-28-24-33(25-29-35)39-18-9-19-41-40-16-5-6-21-43(40)46-44(39)41/h1-29H/i1D,3D,7D,10D,12D,14D,17D,22D,23D,26D,27D |
| InChIKey | HNIJXKVQNCVPMF-KMCZRMNGSA-N |
| XLogP | 12.70 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |