C63H52N4 — CID 171727139
N,4-bis(9,9-dimethylfluoren-2-yl)-N,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-amine (PubChem CID 171727139) has the molecular formula C63H52N4 and a molecular weight of 865.14 g/mol. Its IUPAC name is N,4-bis(9,9-dimethylfluoren-2-yl)-N,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | N,4-bis(9,9-dimethylfluoren-2-yl)-N,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 171727139 |
| Molecular Formula | C63H52N4 |
| Molecular Weight | 865.14 g/mol |
| Exact Mass | 864.42 |
| IUPAC Name | N,4-bis(9,9-dimethylfluoren-2-yl)-N,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(N(c4ccc5c(c4)-c4ccccc4C5(C)C)c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)ccc21 |
| InChI | InChI=1S/C63H52N4/c1-60(2)51-23-15-11-19-43(51)47-33-37(26-31-53(47)60)57-64-58(38-25-29-45-41-17-9-13-21-49(41)62(5,6)55(45)34-38)66-59(65-57)67(39-28-32-54-48(35-39)44-20-12-16-24-52(44)61(54,3)4)40-27-30-46-42-18-10-14-22-50(42)63(7,8)56(46)36-40/h9-36H,1-8H3 |
| InChIKey | HDVMYVQZIZJRJT-UHFFFAOYSA-N |
| XLogP | 15.90 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.14 |
| LogP ≤ 5 | 15.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |