C48H34N4 — CID 171724617
1,2,3,4,5,6,7,8-octadeuterio-9-[5-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]carbazole (PubChem CID 171724617) has the molecular formula C48H34N4 and a molecular weight of 674.88 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[5-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 171724617 |
| Molecular Formula | C48H34N4 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)-c3ccccc3C4(C)C)n2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C48H34N4/c1-48(2)40-22-12-9-19-36(40)39-29-33(26-28-41(39)48)46-49-45(32-17-7-4-8-18-32)50-47(51-46)34-25-27-35(31-15-5-3-6-16-31)44(30-34)52-42-23-13-10-20-37(42)38-21-11-14-24-43(38)52/h3-30H,1-2H3/i10D,11D,13D,14D,20D,21D,23D,24D |
| InChIKey | TWCRWWVXEAXAPH-VNCFNXEZSA-N |
| XLogP | 11.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |