C51H34N4 — CID 170658973
1,2,3,4,5,6,7,8-octadeuterio-9-[5-(3,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 170658973) has the molecular formula C51H34N4 and a molecular weight of 710.91 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(3,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(3,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 170658973 |
| Molecular Formula | C51H34N4 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(3,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)ccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C51H34N4/c1-5-17-35(18-6-1)40-31-41(36-19-7-2-8-20-36)33-42(32-40)39-29-30-45(48(34-39)55-46-27-15-13-25-43(46)44-26-14-16-28-47(44)55)51-53-49(37-21-9-3-10-22-37)52-50(54-51)38-23-11-4-12-24-38/h1-34H/i13D,14D,15D,16D,25D,26D,27D,28D |
| InChIKey | HJVOPDORJIPYGF-BJKITNDTSA-N |
| XLogP | 12.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |