C45H30N4 — CID 177275500
1,2,3,4-tetradeuterio-7-(3,5-diphenylphenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 177275500) has the molecular formula C45H30N4 and a molecular weight of 630.79 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-7-(3,5-diphenylphenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-7-(3,5-diphenylphenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 177275500 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 1,2,3,4-tetradeuterio-7-(3,5-diphenylphenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc1n2-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C45H30N4/c1-5-15-31(16-6-1)36-27-37(32-17-7-2-8-18-32)29-38(28-36)35-25-26-40-39-23-13-14-24-41(39)49(42(40)30-35)45-47-43(33-19-9-3-10-20-33)46-44(48-45)34-21-11-4-12-22-34/h1-30H/i13D,14D,23D,24D |
| InChIKey | IPSBBJLCLMNAOF-KFLHRNFPSA-N |
| XLogP | 11.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |