C39H26N4 — CID 177113402
1,2,3,4-tetradeuterio-7-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 177113402) has the molecular formula C39H26N4 and a molecular weight of 559.72 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-7-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-7-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 177113402 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 1,2,3,4-tetradeuterio-7-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c4c([2H])c([2H])c([2H])c([2H])c4n(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H26N4/c1-4-13-27(14-5-1)30-19-12-20-32(25-30)38-40-37(29-17-8-3-9-18-29)41-39(42-38)43-35-22-11-10-21-33(35)34-24-23-31(26-36(34)43)28-15-6-2-7-16-28/h1-26H/i2D,6D,7D,10D,11D,15D,16D,21D,22D |
| InChIKey | REDPUEZWLRFIED-YIWWXCBQSA-N |
| XLogP | 9.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |