C45H28N4O — CID 177113419
1,2,3,4-tetradeuterio-9-[4-dibenzofuran-2-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 177113419) has the molecular formula C45H28N4O and a molecular weight of 649.80 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-2-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-2-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 177113419 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-2-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c4c([2H])c([2H])c([2H])c([2H])c4n(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc6oc7ccccc7c6c5)n4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H28N4O/c1-3-11-29(12-4-1)31-19-21-32(22-20-31)43-46-44(34-24-26-42-38(27-34)37-16-8-10-18-41(37)50-42)48-45(47-43)49-39-17-9-7-15-35(39)36-25-23-33(28-40(36)49)30-13-5-2-6-14-30/h1-28H/i2D,5D,6D,7D,9D,13D,14D,15D,17D |
| InChIKey | ZXDBNENVYYLBQD-TVMYBXNHSA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |