C45H26N4O2 — CID 168770005
1,2,3,4,5,6,7,8-octadeuterio-9-[4-(7-dibenzofuran-4-yldibenzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 168770005) has the molecular formula C45H26N4O2 and a molecular weight of 662.78 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[4-(7-dibenzofuran-4-yldibenzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[4-(7-dibenzofuran-4-yldibenzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 168770005 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[4-(7-dibenzofuran-4-yldibenzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1nc(-c2ccccc2)nc(-c2ccc3oc4cc(-c5cccc6c5oc5ccccc56)ccc4c3c2)n1 |
| InChI | InChI=1S/C45H26N4O2/c1-2-11-27(12-3-1)43-46-44(48-45(47-43)49-37-18-7-4-13-31(37)32-14-5-8-19-38(32)49)29-22-24-40-36(25-29)34-23-21-28(26-41(34)50-40)30-16-10-17-35-33-15-6-9-20-39(33)51-42(30)35/h1-26H/i4D,5D,7D,8D,13D,14D,18D,19D |
| InChIKey | QHODVEFMJUELGJ-QFRVDIDMSA-N |
| XLogP | 11.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |