C63H37N5O2 — CID 177130463
9-[2-[4-carbazol-9-yl-6-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole (PubChem CID 177130463) has the molecular formula C63H37N5O2 and a molecular weight of 903.06 g/mol. Its IUPAC name is 9-[2-[4-carbazol-9-yl-6-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole.
| Compound Name | 9-[2-[4-carbazol-9-yl-6-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole |
|---|---|
| PubChem CID | 177130463 |
| Molecular Formula | C63H37N5O2 |
| Molecular Weight | 903.06 g/mol |
| Exact Mass | 902.34 |
| IUPAC Name | 9-[2-[4-carbazol-9-yl-6-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3cccc4c3oc3ccc(-c5cccc6c5oc5ccccc56)cc34)c2)nc(-n2c3ccccc3c3ccccc32)n1 |
| InChI | InChI=1S/C63H37N5O2/c1-7-28-52-43(18-1)44-19-2-8-29-53(44)67(52)56-32-11-5-23-50(56)62-64-61(65-63(66-62)68-54-30-9-3-20-45(54)46-21-4-10-31-55(46)68)40-17-13-16-38(36-40)41-24-15-27-49-51-37-39(34-35-58(51)70-60(41)49)42-25-14-26-48-47-22-6-12-33-57(47)69-59(42)48/h1-37H/i1D,2D,7D,18D,19D,28D,29D |
| InChIKey | XYAJRQDKDZGSGS-SVZZAHSPSA-N |
| XLogP | 16.53 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.06 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |