C60H35N5O2 — CID 177130706
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130706) has the molecular formula C60H35N5O2 and a molecular weight of 865.02 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130706 |
| Molecular Formula | C60H35N5O2 |
| Molecular Weight | 865.02 g/mol |
| Exact Mass | 864.32 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-dibenzofuran-4-yldibenzofuran-4-yl)phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3cccc4c3oc3ccc(-c5cccc6c5oc5ccccc56)cc34)c2)nc(-c2cccc3ncccc23)n1 |
| InChI | InChI=1S/C60H35N5O2/c1-5-27-51-42(16-1)43-17-2-6-28-52(43)65(51)53-29-7-3-19-48(53)60-63-58(62-59(64-60)47-24-12-26-50-41(47)25-13-33-61-50)38-15-9-14-36(34-38)39-20-11-23-46-49-35-37(31-32-55(49)67-57(39)46)40-21-10-22-45-44-18-4-8-30-54(44)66-56(40)45/h1-35H/i1D,2D,5D,16D,17D,27D,28D |
| InChIKey | BEUAPDCSOJHLFC-NHDYRCMFSA-N |
| XLogP | 15.65 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.02 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |