C61H38N4O — CID 177130618
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(4-naphthalen-1-ylphenyl)-6-[3-(8-phenyldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130618) has the molecular formula C61H38N4O and a molecular weight of 850.04 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(4-naphthalen-1-ylphenyl)-6-[3-(8-phenyldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(4-naphthalen-1-ylphenyl)-6-[3-(8-phenyldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130618 |
| Molecular Formula | C61H38N4O |
| Molecular Weight | 850.04 g/mol |
| Exact Mass | 849.35 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(4-naphthalen-1-ylphenyl)-6-[3-(8-phenyldibenzofuran-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2ccc(-c3cccc4ccccc34)cc2)nc(-c2cccc(-c3cccc4c3oc3ccc(-c5ccccc5)cc34)c2)n1 |
| InChI | InChI=1S/C61H38N4O/c1-2-15-39(16-3-1)43-35-36-57-53(38-43)51-27-14-26-48(58(51)66-57)44-19-12-20-45(37-44)60-62-59(42-33-31-41(32-34-42)47-25-13-18-40-17-4-5-21-46(40)47)63-61(64-60)52-24-8-11-30-56(52)65-54-28-9-6-22-49(54)50-23-7-10-29-55(50)65/h1-38H/i6D,7D,9D,22D,23D,28D,29D |
| InChIKey | SSJJWDKAQOYHRM-ZCMYVUPSSA-N |
| XLogP | 16.02 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.04 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |