C63H38N4O — CID 177130467
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-phenyldibenzofuran-4-yl)phenyl]-6-triphenylen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130467) has the molecular formula C63H38N4O and a molecular weight of 874.07 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-phenyldibenzofuran-4-yl)phenyl]-6-triphenylen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-phenyldibenzofuran-4-yl)phenyl]-6-triphenylen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130467 |
| Molecular Formula | C63H38N4O |
| Molecular Weight | 874.07 g/mol |
| Exact Mass | 873.35 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(8-phenyldibenzofuran-4-yl)phenyl]-6-triphenylen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3cccc4c3oc3ccc(-c5ccccc5)cc34)c2)nc(-c2ccc3c4ccccc4c4ccccc4c3c2)n1 |
| InChI | InChI=1S/C63H38N4O/c1-2-16-39(17-3-1)40-33-35-59-55(37-40)52-28-15-27-44(60(52)68-59)41-18-14-19-42(36-41)61-64-62(43-32-34-49-47-22-5-4-20-45(47)46-21-6-7-23-48(46)54(49)38-43)66-63(65-61)53-26-10-13-31-58(53)67-56-29-11-8-24-50(56)51-25-9-12-30-57(51)67/h1-38H/i8D,9D,11D,24D,25D,29D,30D |
| InChIKey | ACVKVVHQVDPQPY-MMWGUGICSA-N |
| XLogP | 16.66 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.07 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|