C55H34N4O — CID 177130575
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(3-dibenzofuran-4-ylphenyl)-6-(4-phenylnaphthalen-1-yl)-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130575) has the molecular formula C55H34N4O and a molecular weight of 773.95 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(3-dibenzofuran-4-ylphenyl)-6-(4-phenylnaphthalen-1-yl)-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(3-dibenzofuran-4-ylphenyl)-6-(4-phenylnaphthalen-1-yl)-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130575 |
| Molecular Formula | C55H34N4O |
| Molecular Weight | 773.95 g/mol |
| Exact Mass | 773.32 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-(3-dibenzofuran-4-ylphenyl)-6-(4-phenylnaphthalen-1-yl)-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3cccc4c3oc3ccccc34)c2)nc(-c2ccc(-c3ccccc3)c3ccccc23)n1 |
| InChI | InChI=1S/C55H34N4O/c1-2-16-35(17-3-1)38-32-33-46(41-21-5-4-20-40(38)41)54-56-53(37-19-14-18-36(34-37)39-26-15-27-45-44-24-9-13-31-51(44)60-52(39)45)57-55(58-54)47-25-8-12-30-50(47)59-48-28-10-6-22-42(48)43-23-7-11-29-49(43)59/h1-34H/i6D,7D,10D,22D,23D,28D,29D |
| InChIKey | CUPAUUUDZXGEIZ-CJNWBQIBSA-N |
| XLogP | 14.36 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.95 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |