C51H30N4OS — CID 172525850
1,3,4,5,6,8-hexadeuterio-9-[5-dibenzofuran-4-yl-2-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 172525850) has the molecular formula C51H30N4OS and a molecular weight of 752.93 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[5-dibenzofuran-4-yl-2-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[5-dibenzofuran-4-yl-2-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 172525850 |
| Molecular Formula | C51H30N4OS |
| Molecular Weight | 752.93 g/mol |
| Exact Mass | 752.25 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[5-dibenzofuran-4-yl-2-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cc(-c2cccc3c2oc2ccccc23)ccc1-c1nc(-c2ccccc2)nc(-c2ccc3sc4ccccc4c3c2)n1 |
| InChI | InChI=1S/C51H30N4OS/c1-2-13-31(14-3-1)49-52-50(33-26-28-47-41(29-33)38-18-7-11-24-46(38)57-47)54-51(53-49)40-27-25-32(34-19-12-20-39-37-17-6-10-23-45(37)56-48(34)39)30-44(40)55-42-21-8-4-15-35(42)36-16-5-9-22-43(36)55/h1-30H/i4D,5D,15D,16D,21D,22D |
| InChIKey | ZBLOQQVQZDFNFQ-KYMJKVMKSA-N |
| XLogP | 13.90 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.93 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |