C45H28N4O — CID 176851638
1,3,4,5,6,8-hexadeuterio-9-[5-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]carbazole (PubChem CID 176851638) has the molecular formula C45H28N4O and a molecular weight of 646.78 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[5-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[5-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 176851638 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[5-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccccc34)n2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C45H28N4O/c1-3-13-29(14-4-1)33-25-23-31(27-40(33)49-38-20-10-7-17-34(38)35-18-8-11-21-39(35)49)44-46-43(30-15-5-2-6-16-30)47-45(48-44)32-24-26-37-36-19-9-12-22-41(36)50-42(37)28-32/h1-28H/i7D,8D,17D,18D,20D,21D |
| InChIKey | BWVUHPAEWHUFRL-SVWKLGTDSA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |