C57H36N4O — CID 169007877
9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyldibenzofuran-2-yl]-1,3,4,5,6,8-hexadeuteriocarbazole (PubChem CID 169007877) has the molecular formula C57H36N4O and a molecular weight of 798.98 g/mol. Its IUPAC name is 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyldibenzofuran-2-yl]-1,3,4,5,6,8-hexadeuteriocarbazole.
| Compound Name | 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyldibenzofuran-2-yl]-1,3,4,5,6,8-hexadeuteriocarbazole |
|---|---|
| PubChem CID | 169007877 |
| Molecular Formula | C57H36N4O |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.33 |
| IUPAC Name | 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyldibenzofuran-2-yl]-1,3,4,5,6,8-hexadeuteriocarbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cc(-c2ccccc2)c2oc3cc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)ccc3c2c1 |
| InChI | InChI=1S/C57H36N4O/c1-4-14-37(15-5-1)39-24-28-42(29-25-39)55-58-56(43-30-26-40(27-31-43)38-16-6-2-7-17-38)60-57(59-55)44-32-33-48-50-36-45(35-49(41-18-8-3-9-19-41)54(50)62-53(48)34-44)61-51-22-12-10-20-46(51)47-21-11-13-23-52(47)61/h1-36H/i10D,11D,20D,21D,22D,23D |
| InChIKey | AIDABDJYDMIVSN-UNRWONNESA-N |
| XLogP | 14.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |