C57H36N4O — CID 169007885
1,3,4,5,6,8-hexadeuterio-9-[7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-phenyldibenzofuran-2-yl]carbazole (PubChem CID 169007885) has the molecular formula C57H36N4O and a molecular weight of 798.98 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-phenyldibenzofuran-2-yl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-phenyldibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 169007885 |
| Molecular Formula | C57H36N4O |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.33 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-phenyldibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cc(-c2ccccc2)c2oc3cc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)ccc3c2c1 |
| InChI | InChI=1S/C57H36N4O/c1-4-16-37(17-5-1)49-35-45(61-51-28-12-10-26-46(51)47-27-11-13-29-52(47)61)36-50-48-31-30-43(34-53(48)62-54(49)50)41-23-14-22-40(32-41)42-24-15-25-44(33-42)57-59-55(38-18-6-2-7-19-38)58-56(60-57)39-20-8-3-9-21-39/h1-36H/i10D,11D,26D,27D,28D,29D |
| InChIKey | SCWHSUFUPUATES-SAAPVWCOSA-N |
| XLogP | 14.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |