C57H35N5O — CID 162780713
9-[3-[4-[2-carbazol-9-yl-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 162780713) has the molecular formula C57H35N5O and a molecular weight of 810.97 g/mol. Its IUPAC name is 9-[3-[4-[2-carbazol-9-yl-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[3-[4-[2-carbazol-9-yl-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 162780713 |
| Molecular Formula | C57H35N5O |
| Molecular Weight | 810.97 g/mol |
| Exact Mass | 810.32 |
| IUPAC Name | 9-[3-[4-[2-carbazol-9-yl-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2c(-c4nc(-c5ccccc5)nc(-c5cccc(-n6c7ccccc7c7ccccc76)c5)n4)cc(-n4c5ccccc5c5ccccc54)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C57H35N5O/c1-3-16-36(17-4-1)38-30-31-46-47-34-41(62-51-28-13-9-24-44(51)45-25-10-14-29-52(45)62)35-48(54(47)63-53(46)33-38)57-59-55(37-18-5-2-6-19-37)58-56(60-57)39-20-15-21-40(32-39)61-49-26-11-7-22-42(49)43-23-8-12-27-50(43)61/h1-35H/i1D,3D,4D,16D,17D |
| InChIKey | LVEAEQSRSYMDAQ-DQWZHVRJSA-N |
| XLogP | 14.63 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.97 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |