C57H36N4O — CID 162780284
9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzofuran-2-yl]carbazole (PubChem CID 162780284) has the molecular formula C57H36N4O and a molecular weight of 797.97 g/mol. Its IUPAC name is 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzofuran-2-yl]carbazole.
| Compound Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 162780284 |
| Molecular Formula | C57H36N4O |
| Molecular Weight | 797.97 g/mol |
| Exact Mass | 797.32 |
| IUPAC Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3oc3c(-c5cccc(-c6ccccc6)c5)cccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C57H36N4O/c1-4-16-37(17-5-1)39-30-32-41(33-31-39)56-58-55(40-20-8-3-9-21-40)59-57(60-56)50-36-44(61-51-28-12-10-24-46(51)47-25-11-13-29-52(47)61)35-49-48-27-15-26-45(53(48)62-54(49)50)43-23-14-22-42(34-43)38-18-6-2-7-19-38/h1-36H/i3D,8D,9D,20D,21D |
| InChIKey | XBOSJYDRBWSWSH-YBWSHAMKSA-N |
| XLogP | 14.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.97 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |