C53H32N4O — CID 162780689
9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-8-phenanthren-2-yldibenzofuran-2-yl]carbazole (PubChem CID 162780689) has the molecular formula C53H32N4O and a molecular weight of 745.90 g/mol. Its IUPAC name is 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-8-phenanthren-2-yldibenzofuran-2-yl]carbazole.
| Compound Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-8-phenanthren-2-yldibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 162780689 |
| Molecular Formula | C53H32N4O |
| Molecular Weight | 745.90 g/mol |
| Exact Mass | 745.29 |
| IUPAC Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-8-phenanthren-2-yldibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3oc3ccc(-c5ccc6c(ccc7ccccc76)c5)cc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H32N4O/c1-3-14-34(15-4-1)51-54-52(35-16-5-2-6-17-35)56-53(55-51)46-32-39(57-47-21-11-9-19-42(47)43-20-10-12-22-48(43)57)31-45-44-30-37(26-28-49(44)58-50(45)46)36-25-27-41-38(29-36)24-23-33-13-7-8-18-40(33)41/h1-32H/i1D,3D,4D,14D,15D |
| InChIKey | IEALTNXLAGYQIS-PHQJSJDESA-N |
| XLogP | 13.84 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.90 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|