C59H36N4O — CID 162780287
9-[7-phenyl-4-[4-phenyl-6-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]carbazole (PubChem CID 162780287) has the molecular formula C59H36N4O and a molecular weight of 820.99 g/mol. Its IUPAC name is 9-[7-phenyl-4-[4-phenyl-6-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]carbazole.
| Compound Name | 9-[7-phenyl-4-[4-phenyl-6-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 162780287 |
| Molecular Formula | C59H36N4O |
| Molecular Weight | 820.99 g/mol |
| Exact Mass | 820.31 |
| IUPAC Name | 9-[7-phenyl-4-[4-phenyl-6-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c(-c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1nc(-c2ccccc2)nc(-c2cc(-n3c4ccccc4c4ccccc43)cc3c2oc2cc(-c4ccccc4)ccc23)n1 |
| InChI | InChI=1S/C59H36N4O/c1-3-15-37(16-4-1)41-31-32-49-51-35-43(63-53-25-13-11-23-47(53)48-24-12-14-26-54(48)63)36-52(56(51)64-55(49)34-41)59-61-57(39-17-5-2-6-18-39)60-58(62-59)40-29-27-38(28-30-40)50-33-42-19-7-8-20-44(42)45-21-9-10-22-46(45)50/h1-36H/i27D,28D,29D,30D |
| InChIKey | UFWHJXTWYUDWGQ-OCUCCEAMSA-N |
| XLogP | 15.51 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.99 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|