C54H36N4O — CID 162780775
9-[4-[4-(9,9-dimethylfluoren-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole (PubChem CID 162780775) has the molecular formula C54H36N4O and a molecular weight of 761.94 g/mol. Its IUPAC name is 9-[4-[4-(9,9-dimethylfluoren-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole.
| Compound Name | 9-[4-[4-(9,9-dimethylfluoren-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 162780775 |
| Molecular Formula | C54H36N4O |
| Molecular Weight | 761.94 g/mol |
| Exact Mass | 761.32 |
| IUPAC Name | 9-[4-[4-(9,9-dimethylfluoren-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2c(-c4nc(-c5ccccc5)nc(-c5cccc6c5-c5ccccc5C6(C)C)n4)cc(-n4c5ccccc5c5ccccc54)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C54H36N4O/c1-54(2)44-24-12-9-22-40(44)49-41(23-15-25-45(49)54)52-55-51(34-18-7-4-8-19-34)56-53(57-52)43-32-36(58-46-26-13-10-20-37(46)38-21-11-14-27-47(38)58)31-42-39-29-28-35(30-48(39)59-50(42)43)33-16-5-3-6-17-33/h3-32H,1-2H3/i3D,5D,6D,16D,17D |
| InChIKey | AUFSBMJLOZRCSO-RXCWOGKYSA-N |
| XLogP | 13.84 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.94 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |