C54H37N3O — CID 170681134
2-(9,9-dimethylfluoren-4-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[3-[9-(4-phenylphenyl)dibenzofuran-3-yl]phenyl]-1,3,5-triazine (PubChem CID 170681134) has the molecular formula C54H37N3O and a molecular weight of 748.94 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-4-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[3-[9-(4-phenylphenyl)dibenzofuran-3-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-4-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[3-[9-(4-phenylphenyl)dibenzofuran-3-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170681134 |
| Molecular Formula | C54H37N3O |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.33 |
| IUPAC Name | 2-(9,9-dimethylfluoren-4-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[3-[9-(4-phenylphenyl)dibenzofuran-3-yl]phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4ccc5c(c4)oc4cccc(-c6ccc(-c7ccccc7)cc6)c45)c3)nc(-c3cccc4c3-c3ccccc3C4(C)C)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H37N3O/c1-54(2)45-23-10-9-20-42(45)49-44(22-12-24-46(49)54)53-56-51(37-16-7-4-8-17-37)55-52(57-53)40-19-11-18-38(32-40)39-30-31-43-48(33-39)58-47-25-13-21-41(50(43)47)36-28-26-35(27-29-36)34-14-5-3-6-15-34/h3-33H,1-2H3/i4D,7D,8D,16D,17D |
| InChIKey | RZSNMSJJLWRWNC-NCIOFBODSA-N |
| XLogP | 14.08 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |