C42H29N3O — CID 170681145
2-(9,9-dimethylfluoren-3-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 170681145) has the molecular formula C42H29N3O and a molecular weight of 596.74 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-3-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-3-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170681145 |
| Molecular Formula | C42H29N3O |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 2-(9,9-dimethylfluoren-3-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)-c3ccccc3C4(C)C)nc(-c3ccc4c(c3)oc3cccc(-c5ccccc5)c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C42H29N3O/c1-42(2)34-18-10-9-16-31(34)33-24-28(21-23-35(33)42)40-43-39(27-14-7-4-8-15-27)44-41(45-40)29-20-22-32-37(25-29)46-36-19-11-17-30(38(32)36)26-12-5-3-6-13-26/h3-25H,1-2H3/i4D,7D,8D,14D,15D |
| InChIKey | NGRNUAXTIQXGDW-QWENWVADSA-N |
| XLogP | 10.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |