C45H28N4O — CID 172525899
9-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-4-dibenzofuran-4-ylphenyl]-1,3,4,5,6,8-hexadeuteriocarbazole (PubChem CID 172525899) has the molecular formula C45H28N4O and a molecular weight of 656.84 g/mol. Its IUPAC name is 9-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-4-dibenzofuran-4-ylphenyl]-1,3,4,5,6,8-hexadeuteriocarbazole.
| Compound Name | 9-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-4-dibenzofuran-4-ylphenyl]-1,3,4,5,6,8-hexadeuteriocarbazole |
|---|---|
| PubChem CID | 172525899 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | 9-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-4-dibenzofuran-4-ylphenyl]-1,3,4,5,6,8-hexadeuteriocarbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1ccc(-c2cccc3c2oc2ccccc23)cc1-c1nc(-c2c([2H])c([2H])c([2H])c([2H])c2[2H])nc(-c2c([2H])c([2H])c([2H])c([2H])c2[2H])n1 |
| InChI | InChI=1S/C45H28N4O/c1-3-14-29(15-4-1)43-46-44(30-16-5-2-6-17-30)48-45(47-43)37-28-31(32-21-13-22-36-35-20-9-12-25-41(35)50-42(32)36)26-27-40(37)49-38-23-10-7-18-33(38)34-19-8-11-24-39(34)49/h1-28H/i1D,2D,3D,4D,5D,6D,7D,8D,14D,15D,16D,17D,18D,19D,23D,24D |
| InChIKey | SLPDLKZMGKVTBX-FIPSLRNASA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |