C53H32N4O — CID 172525687
1,3,4,5,6,8-hexadeuterio-9-[4-dibenzofuran-4-yl-2-(4-phenanthren-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 172525687) has the molecular formula C53H32N4O and a molecular weight of 746.90 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[4-dibenzofuran-4-yl-2-(4-phenanthren-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[4-dibenzofuran-4-yl-2-(4-phenanthren-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 172525687 |
| Molecular Formula | C53H32N4O |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.30 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[4-dibenzofuran-4-yl-2-(4-phenanthren-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1ccc(-c2cccc3c2oc2ccccc23)cc1-c1nc(-c2ccccc2)nc(-c2cc3ccccc3c3ccccc23)n1 |
| InChI | InChI=1S/C53H32N4O/c1-2-15-33(16-3-1)51-54-52(44-31-34-17-4-5-18-36(34)38-19-6-7-20-39(38)44)56-53(55-51)45-32-35(37-24-14-25-43-42-23-10-13-28-49(42)58-50(37)43)29-30-48(45)57-46-26-11-8-21-40(46)41-22-9-12-27-47(41)57/h1-32H/i8D,9D,21D,22D,26D,27D |
| InChIKey | LLOLBKHPWPJMGW-ODIMJPCFSA-N |
| XLogP | 13.84 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|