C30H18ClNO — CID 172525825
9-(2-chloro-4-dibenzofuran-4-ylphenyl)-1,3,4,5,6,8-hexadeuteriocarbazole (PubChem CID 172525825) has the molecular formula C30H18ClNO and a molecular weight of 449.97 g/mol. Its IUPAC name is 9-(2-chloro-4-dibenzofuran-4-ylphenyl)-1,3,4,5,6,8-hexadeuteriocarbazole.
| Compound Name | 9-(2-chloro-4-dibenzofuran-4-ylphenyl)-1,3,4,5,6,8-hexadeuteriocarbazole |
|---|---|
| PubChem CID | 172525825 |
| Molecular Formula | C30H18ClNO |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 9-(2-chloro-4-dibenzofuran-4-ylphenyl)-1,3,4,5,6,8-hexadeuteriocarbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1ccc(-c2cccc3c2oc2ccccc23)cc1Cl |
| InChI | InChI=1S/C30H18ClNO/c31-25-18-19(20-11-7-12-24-23-10-3-6-15-29(23)33-30(20)24)16-17-28(25)32-26-13-4-1-8-21(26)22-9-2-5-14-27(22)32/h1-18H/i1D,2D,8D,9D,13D,14D |
| InChIKey | SUXMVDBDXOAZNO-NHHGYIAQSA-N |
| XLogP | 9.00 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |