C49H30N4O — CID 177130464
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)phenyl]-6-naphthalen-1-yl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130464) has the molecular formula C49H30N4O and a molecular weight of 704.89 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)phenyl]-6-naphthalen-1-yl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)phenyl]-6-naphthalen-1-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130464 |
| Molecular Formula | C49H30N4O |
| Molecular Weight | 704.89 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-[3-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)phenyl]-6-naphthalen-1-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3c([2H])c([2H])c([2H])c4c3oc3c([2H])c([2H])c([2H])c([2H])c34)c2)nc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C49H30N4O/c1-2-18-34-31(14-1)15-12-25-40(34)48-50-47(33-17-11-16-32(30-33)35-23-13-24-39-38-21-6-10-29-45(38)54-46(35)39)51-49(52-48)41-22-5-9-28-44(41)53-42-26-7-3-19-36(42)37-20-4-8-27-43(37)53/h1-30H/i3D,4D,6D,7D,10D,13D,19D,20D,21D,23D,24D,26D,27D,29D |
| InChIKey | UVOLBQLJCAQVJV-GWTAHUSBSA-N |
| XLogP | 12.69 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.89 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |