C43H28N4 — CID 170658880
1,2,3,4,5,6,7,8-octadeuterio-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-1-ylphenyl]carbazole (PubChem CID 170658880) has the molecular formula C43H28N4 and a molecular weight of 608.77 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-1-ylphenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-1-ylphenyl]carbazole |
|---|---|
| PubChem CID | 170658880 |
| Molecular Formula | C43H28N4 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-1-ylphenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C43H28N4/c1-3-15-30(16-4-1)41-44-42(31-17-5-2-6-18-31)46-43(45-41)32-26-27-37(34-23-13-19-29-14-7-8-20-33(29)34)40(28-32)47-38-24-11-9-21-35(38)36-22-10-12-25-39(36)47/h1-28H/i9D,10D,11D,12D,21D,22D,24D,25D |
| InChIKey | MKJYCXFRGBAUKY-KQIATUETSA-N |
| XLogP | 10.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |