C57H36N4 — CID 162496980
1,2,3,4,5,6,7,8-octadeuterio-9-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]triphenylen-2-yl]carbazole (PubChem CID 162496980) has the molecular formula C57H36N4 and a molecular weight of 784.99 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]triphenylen-2-yl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]triphenylen-2-yl]carbazole |
|---|---|
| PubChem CID | 162496980 |
| Molecular Formula | C57H36N4 |
| Molecular Weight | 784.99 g/mol |
| Exact Mass | 784.34 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]triphenylen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cc2c3ccccc3c3ccccc3c2cc1-c1cccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C57H36N4/c1-3-17-37(18-4-1)55-58-56(38-19-5-2-6-20-38)60-57(59-55)42-24-16-22-40(34-42)39-21-15-23-41(33-39)49-35-50-45-27-9-7-25-43(45)44-26-8-10-28-46(44)51(50)36-54(49)61-52-31-13-11-29-47(52)48-30-12-14-32-53(48)61/h1-36H/i11D,12D,13D,14D,29D,30D,31D,32D |
| InChIKey | SMWDCSAUHPXUBE-XWCLVCJJSA-N |
| XLogP | 14.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.99 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|