C45H30N4 — CID 177113447
1,2,3,4-tetradeuterio-9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 177113447) has the molecular formula C45H30N4 and a molecular weight of 635.82 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 177113447 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c4c([2H])c([2H])c([2H])c([2H])c4n(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H30N4/c1-4-15-31(16-5-1)38-26-14-27-40-39-25-10-11-28-41(39)49(42(38)40)37-24-13-22-35(30-37)34-21-12-23-36(29-34)45-47-43(32-17-6-2-7-18-32)46-44(48-45)33-19-8-3-9-20-33/h1-30H/i1D,4D,5D,10D,11D,15D,16D,25D,28D |
| InChIKey | BDCQPTXUCSGRIX-RSGGLORPSA-N |
| XLogP | 11.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |