C39H26N4 — CID 166046909
9-[3-[3-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole (PubChem CID 166046909) has the molecular formula C39H26N4 and a molecular weight of 568.77 g/mol. Its IUPAC name is 9-[3-[3-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole.
| Compound Name | 9-[3-[3-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
|---|---|
| PubChem CID | 166046909 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | 9-[3-[3-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4cccc(-n5c6c([2H])c([2H])c([2H])c([2H])c6c6c([2H])c([2H])c([2H])c([2H])c65)c4)c3)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H26N4/c1-3-13-27(14-4-1)37-40-38(28-15-5-2-6-16-28)42-39(41-37)31-19-11-17-29(25-31)30-18-12-20-32(26-30)43-35-23-9-7-21-33(35)34-22-8-10-24-36(34)43/h1-26H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,13D,14D,15D,16D,21D,22D,23D,24D |
| InChIKey | JXRJWKCXUSLMKK-JKASTTPJSA-N |
| XLogP | 9.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |